4-Nitrophenyl b-D-mannopyranoside
4-Nitrophenyl b-D-mannopyranoside, a biomedical compound, plays a pivotal role in advancing diagnostic tools and therapeutic strategies for specific diseases through cutting-edge research and development. It finds extensive utilization in the exploration of enzyme activity, particularly in the realm of carbohydrate metabolism, offering valuable insights into the intricate interplay between enzymes and substrates.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35599-02-1 |
| Pricing | Inquire |
| Cas | 35599-02-1 |
| Molecular Weight | 301.25 |
| Molecular Formula | C12H15NO8 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O |