Uridine 5'-Monophosphomorpholidate 4-Morpholine-N,N'-dicyclohexylcarboxamidine Salt
Uridine 5'-Monophosphomorpholidate 4-Morpholine-N,N'-dicyclohexylcarboxamidine Salt is used to synthesize several organic compounds including Uridine 5'-(5-thio-α-D-glucopyranosyl pyrophosphate) that is a potent activator of rat liver glycogen synthetase. It was used as a reagent in glycoprotein labelling with click chemistry and carbohydrate detection. Also used in the preparation of UDP-3-O[R-3-Hydroxymyristoyl]-N-acetylglucosamine Tris Salt.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24558-91-6 |
| Pricing | Inquire |
| Cas | 24558-91-6 |
| Molecular Weight | 393.29 |
| Molecular Formula | C13H20N3O9P•C17H31N3O |
| Canonical SMILES | C1CCC(CC1)NC(=NC2CCCCC2)N3CCOCC3.C1COCCN1P(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O |