18:1 DGPP (ammonium salt)
Diacylglycerol pyrophosphate (DGPP), an anionic phospholipid that is usually found in plants and yeast. It is formed during phosphorylation of phosphatidic acid (PA) with the help of PA kinase (PAK). DGPP can decrease the phosphatidic acid (PA) signal and can acts as a signaling lipid.
| Supplier | BOC Sciences |
|---|---|
| Product # | 474943-14-1 |
| Pricing | Inquire |
| Cas | 474943-14-1 |
| Molecular Weight | 815.01 |
| Molecular Formula | C39H80N2O11P2 |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OP(=O)(O)[O-])OC(=O)CCCCCCCC=CCCCCCCCC.[NH4+].[NH4+] |