Fmoc-D-Lys(Dde)-OH
Fmoc-D-Lys(Dde)-OH, a vital reagent for peptide synthesis, restricts the D-Lysine residue for selective introduction of D-amino acids into the peptide chains. Moreover, the Dde protection group enables mild deprotection under specific conditions during solid-phase synthesis, thus augmenting its applicability. This characteristic formulation, thus, serves as a fundamental component in the preparation of specialized peptides.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003698 |
| Pricing | Inquire |
| Cas | 333973-51-6 |
| Molecular Weight | 532.63 |
| Molecular Formula | C31H36N2O6 |
| Canonical SMILES | CC(=NCCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C4=C(CC(CC4=O)(C)C)O |