2,3,4,6-Tetra-O-acetyl-1-bromo-1-deoxy-b-D-galactopyranosyl cyanide
2,3,4,6-Tetra-O-acetyl-1-bromo-1-deoxy-b-D-galactopyranosyl cyanide, known for its intricate molecular composition, stands as an indispensable entity within the realm of the biomedical industry. Among its notable applications, this compound assumes a pivotal stance in the creation of pharmacological agents aimed at combatting targeted ailments. Capitalizing on its distinctive arrangement, this chemical compound assumes a paramount role in the effective remediation of diverse medical conditions, thus fostering the facilitation of drug exploration and amalgamation processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83497-42-1 |
| Pricing | Inquire |
| Cas | 83497-42-1 |
| Molecular Weight | 436.21 |
| Molecular Formula | C15H18BrNO9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)(C#N)Br)OC(=O)C)OC(=O)C)OC(=O)C |