7-b-D-Ribofuranosyl-7H-tetrazolo[5,1i]purine
7-b-D-Ribofuranosyl-7H-tetrazolo[5,1i]purine, a powerful synthetic compound widely utilized in biomedicine, has attracted significant attention due to its potential as an antiviral agent against an array of viral diseases. Notably, it has garnered considerable scientific interest for its observed activity against herpes simplex virus type 1 (HSV-1), hepatitis B virus (HBV), and human immunodeficiency virus (HIV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 37082-52-3 |
| Pricing | Inquire |
| Cas | 37082-52-3 |
| Molecular Weight | 293.24 |
| Molecular Formula | C10H11N7O4 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=CN4C2=NN=N4 |