SW-100
SW-100 is a tetrahydroquinoline-based selective HDAC6 inhibitor. SW-100 ameliorates several memory and learning impairments in Fmr1-/- mice, thus modeling the intellectual deficiencies associated with FXS, and hence providing a strong rationale for pursuing HDAC6-based therapies for the treatment of this rare disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2126744-35-0 |
| Pricing | Inquire |
| Cas | 2126744-35-0 |
| Molecular Weight | 316.78 |
| Molecular Formula | C17H17ClN2O2 |
| Canonical SMILES | C1CC2=C(C=CC(=C2)Cl)N(C1)CC3=CC=C(C=C3)C(=O)NO |