ARV-471
ARV-471, an oral estrogen receptor PROTAC protein degrader for the treatment of breast cancer, is an heterobifunctional molecule that promotes the interaction between estrogen receptor alpha and intracellular E3 ligase complexes. It leads to ubiquitylation and subsequent degradation of estrogen receptors through the proteasome. In ER positive breast cancer cell lines, it has a strong ability to degrade ER with a half-maximal degradation concentration (DC50) of ~2 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2229711-68-4 |
| Pricing | Inquire |
| Cas | 2229711-68-4 |
| Molecular Weight | 723.90 |
| Molecular Formula | C45H49N5O4 |
| Canonical SMILES | C1CC2=C(C=CC(=C2)O)C(C1C3=CC=CC=C3)C4=CC=C(C=C4)N5CCC(CC5)CN6CCN(CC6)C7=CC8=C(C=C7)C(=O)N(C8)C9CCC(=O)NC9=O |