2-METHOXYISOPHTHALIC ACID
2-Methoxyisophthalic acid is a versatile compound with potential pharmaceutical applications. Its significance arises from its role as an intermediate in the synthesis of diverse drugs and molecules, notably including anti-inflammatory and anticancer agents. Furthermore, this compound exhibits promise in addressing ailments like rheumatoid arthritis and select cancer types.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1951-38-8 |
| Pricing | Inquire |
| Cas | 1951-38-8 |
| Molecular Weight | 196.16 |
| Molecular Formula | C9H8O5 |
| Canonical SMILES | COC1=C(C=CC=C1C(=O)O)C(=O)O |