2-Chloro-6-methoxypurine-9-beta-D-(2'-deoxy-2'-fluoro)-arabinoriboside
2-Chloro-6-methoxypurine-9-beta-D-(2'-deoxy-2'-fluoro)-arabinoriboside, an antiviral drug used for hepatitis C treatment, undermines replication of the virus, thus minimizing its quantity within the body. Additionally, this drug is under scrutiny for its possible application in specific cancer cures, thus, raising its significance in the field of medical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 758705-70-3 |
| Pricing | Inquire |
| Cas | 758705-70-3 |
| Molecular Weight | 318.69 |
| Molecular Formula | C11H12ClFN4O4 |
| Canonical SMILES | COC1=NC(=NC2=C1N=CN2C3C(C(C(O3)CO)O)F)Cl |