3-Bromo-2-methoxy-5-methylphenylboronic acid
3-Bromo-2-methoxy-5-methylphenylboronic acid is a valuable compound utilized in the field of biomedicine. It acts as a crucial reagent in medicinal chemistry by participating in boronate ester formation enabling the synthesis of potential drugs. The compound demonstrates efficacy in treating various diseases such as cancer, inflammation, and metabolic disorders. Its unique chemical structure and potential therapeutic applications make it a significant tool in biomedical research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870717-99-0 |
| Pricing | Inquire |
| Cas | 870717-99-0 |
| Molecular Weight | 244.88 |
| Molecular Formula | C8H10BBrO3 |
| Canonical SMILES | B(C1=CC(=CC(=C1OC)Br)C)(O)O |