Dacomitinib Impurity DFAJ
One of the impurities of Dacomitinib. Dacomitinib, aslo known as PF-299 and PF-00299804 or PF299804, is an orally bioavailable, highly selective, second-generation small-molecule inhibitor of the pan-epidermal growth factor receptor (EGFR) family of tyrosine kinases (ErbB family) with potential antineoplastic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1562180-31-7 |
| Pricing | Inquire |
| Cas | 1562180-31-7 |
| Molecular Weight | 284.29 |
| Molecular Formula | C15H13FN4O |
| Canonical SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC=C(C=C3)F)N |