Suc-Leu-Leu-Val-Tyr-AMC
| Supplier | Creative Peptides |
|---|---|
| Product # | R0808 |
| CAS # | 94367-21-2 |
| Pricing | Inquire |
| BoilingPoint | 1116.8ºC at 760mmHg |
| Synonyms | Suc-LLVY-AMC, Proteasome substrate (fluorogenic), Calpain substrate (fluorogenic) |
| MolecularFormula | C40H53N5O10 |
| MolecularWeight | 763.89 |
| Source | Synthetic |
| Sequence | Suc-Leu-Leu-Val-Tyr-AMC |
| Storage | -20°C |
| Explanation | Suc-Leu-Leu-Val-Tyr-AMC is a fluorogenic substrate of calpains and 20S proteasome and used to study the activity of calpains and proteosomal degradation. It is also a substrate for carboxypeptidase Y, proteinase yscE (kexin), ingensin, as well as for porcine calpain isozymes I and II and for papain. |
| Application | A fluorgenic substrate |
| InChI | InChI=1S/C40H53N5O10/c1-21(2)16-29(42-33(47)14-15-34(48)49)38(52)43-30(17-22(3)4)39(53)45-36(23(5)6)40(54)44-31(19-25-8-11-27(46)12-9-25)37(51)41-26-10-13-28-24(7)18-35(50)55-32(28)20-26/h8-13,18,20-23,29-31,36,46H,14-17,19H2,1-7H3,(H,41,51)(H,42,47)(H,43,52)(H,44,54)(H,45,53)(H,48,49)/t29-,30-,31-,36-/m0/s1 |
| InChIKey | UVFAEQZFLBGVRM-MSMWPWNWSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=C(C=C3)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CCC(=O)O |
| Purity | > 97% |
| AreasOfInterest | Cell Biology |
| LongTermStorageConditions | -20 °C |