2-Nitrobenzyl bromide
2-Nitrobenzyl bromide (CAS# 3958-60-9) is a reagent used in the synthesis of 1,3,4-oxadiazole derivatives possessing a benzotriazole moiety leading to anticancer activity. Also used in the preparation of antifungal triazole derivatives.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3958-60-9 |
| Pricing | Inquire |
| Cas | 3958-60-9 |
| Molecular Weight | 216.03 |
| Molecular Formula | C7H6BrNO2 |
| Canonical SMILES | C1=CC=C(C(=C1)CBr)[N+](=O)[O-] |