N1-Isopropyl-N5-(6-methoxy-8-quinolyl)-1,5-pentanediamine
N1-Isopropyl-N5-(6-methoxy-8-quinolyl)-1,5-pentanediamine (CAS# 86-78-2) is an intermediate used in the synthesis of Chlorpyriphos-methyl-d6 (C425332), which is an isotope labelled Chlorpyriphos-methyl is an derivative of Chlorpyrifos (C425300), an insecticide that acts on the nervous system of insects by inhibiting acetylcholinesterase.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB038065 |
| Pricing | Inquire |
| Cas | 86-78-2 |
| Molecular Weight | 301.43 |
| Molecular Formula | C18H27N3O |
| Canonical SMILES | CC(C)NCCCCCNC1=C2C(=CC(=C1)OC)C=CC=N2 |