Acid black 210
Acid Black 210 is a synthetic food dye commonly used in the biomedical industry to stain proteins and nucleic acids for visualization in gel electrophoresis. It has also been investigated for potential therapeutic effects on various diseases such as cancer and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99576-15-5 |
| Pricing | Inquire |
| Cas | 99576-15-5 |
| Molecular Weight | 938.02 |
| Molecular Formula | C34H25K2N11O11S3 |
| Canonical SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC=C(C=C2)N=NC3=C(C4=C(C(=C(C=C4C=C3S(=O)(=O)[O-])S(=O)(=O)[O-])N=NC5=CC=C(C=C5)[N+](=O)[O-])N)O)N=NC6=C(C=C(C=C6)N)N.[K+].[K+] |