6,8-Difluoro-4-methylumbelliferyl b-D-galactopyranoside
6,8-Difluoro-4-methylumbelliferyl b-D-galactopyranoside is a biochemical compound widely utilized in the biomedical industry for detecting the activity of the enzyme β-galactosidase. This fluorescent substrate is particularly valuable for studying the expression, localization and function of this enzyme in various biological systems aiding in the investigation of genetic disorders, cell signaling pathways and developmental biology.
| Supplier | BOC Sciences |
|---|---|
| Product # | 215868-26-1 |
| Pricing | Inquire |
| Cas | 215868-26-1 |
| Molecular Weight | 374.29 |
| Molecular Formula | C16H16F2O8 |
| Canonical SMILES | CC1=CC(=O)OC2=C(C(=C(C=C12)F)OC3C(C(C(C(O3)CO)O)O)O)F |