BISPHENOL A DIMETHACRYLATE
Bisphenol A dimethacrylate is a bisphenol that is bisphenol A condensed with two molecules of methacrylic acid. It has a role as a metabolite. It is a bisphenol and an enoate ester. It is functionally related to a bisphenol A and a methacrylic acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3253-39-2 |
| Pricing | Inquire |
| Cas | 3253-39-2 |
| Molecular Weight | 364.43 |
| Molecular Formula | C23H24O4 |
| Canonical SMILES | CC(=C)C(=O)OC1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)OC(=O)C(=C)C |