(1R,3S,5R)-5-Methyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid 2-tert-butyl ester
(1R,3S,5R)-5-Methyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid 2-tert-butyl ester can be used to prepare indole analogs as complement factor D inhibitors for treating age-related macular degeneration. It can also be utilized to synthesize hepatitis C virus inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060106 |
| Pricing | Inquire |
| Cas | 1306734-44-0 |
| Molecular Weight | 241.28 |
| Molecular Formula | C12H19NO4 |
| Canonical SMILES | CC12CC(N(C1C2)C(=O)OC(C)(C)C)C(=O)O |