Encenicline, HCl salt
EVP-6124, its alpha-7 nicotinic acetylcholine receptor agonist, possesses a novel mechanism not previously seen in the scientific community: it acts as a co-agonist with Acetylcholine (ACh) to enhance cognition. By acting as a co-agonist and sensitizing the alpha-7 receptor, EVP-6124 makes it possible for smaller amounts of naturally occurring ACh, typically found in individuals with memory disorders such as Alzheimer's, to be required to activate the receptor. In this scenario, research demonstrated that memory deficits can be minimized or entirely reversed by controlling the neuronal channel with EVP-6124 alone or in combination with other Alzheimer's drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 550999-74-1 |
| Pricing | Inquire |
| Cas | 550999-74-1 |
| Molecular Weight | 357.293 |
| Molecular Formula | C16H18Cl2N2OS |
| Canonical SMILES | C1CN2CCC1C(C2)NC(=O)C3=CC4=C(S3)C(=CC=C4)Cl.Cl |