Levothyroxine sodium hydrate

3,3',5,5'-Tetraiodo-L-thyronine sodium saltm is the sodium salt of levothyroxine, a synthetic levoisomer of thyroxine (T4) that is similar to the endogenous hormone produced by the thyroid gland. In peripheral tissues, levothyroxine is deiodinated by 5'-deiodinase to form triiodothyronine (T3). T3 enters the cell and binds to nuclear thyroid hormone receptors, the activated hormone-receptor complex in turn triggers gene expression and produces proteins required in the regulation of cellular respiration, thermogenesis, cellular growth and differentiation, and the metabolism of proteins, carbohydrates and lipids. T3 also exhibits cardiostimulatory effects.
Supplier BOC Sciences
Product # BAT-007813
Pricing Inquire
Cas 25416-65-3
Molecular Weight 816.87
Molecular Formula C15H12I4NNaO5
Canonical SMILES C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)[O-])N.O.[Na+]
Feedback