4-Nitrophenyl 6-deoxy-6-(2-pyridylamino)-a-D-penta-(1-4)-glucopyranoside
4-Nitrophenyl 6-deoxy-6-(2-pyridylamino)-α-D-penta-(1-4)-glucopyranoside is a versatile chemical compound exemplifying its significance lies in the realm of glucosidase inhibitors and the revolutionary field of carbohydrate-based drug design. With its exceptional structure, this compound unveils a gateway to unraveling the enigmatic pathologies associated with enzyme functionality and carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100111-14-6 |
| Pricing | Inquire |
| Cas | 100111-14-6 |
| Molecular Weight | 1025.91 |
| Molecular Formula | C41H59N3O27 |
| Canonical SMILES | C1=CC=NC(=C1)NCCC2C(C(C(C(O2)OC3C(OC(C(C3O)O)OC4C(C(C(OC4O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7=CC=C(C=C7)[N+](=O)[O-])CO)CO)O)O)CO)O)O)O |