2'-Deoxy-5'-O-DMT-N2-ethylguanosine 3'-CE phosphoramidite
2'-Deoxy-5'-O-DMT-N2-ethylguanosine 3'-CE phosphoramidite is a valuable tool in biomedical research. It acts as a building block for the synthesis of modified oligonucleotides. With precise conjugation of N2-ethylguanosine and DMT protection on the 5'-end, this phosphoramidite aids in the modification of RNA, leading to targeted drug delivery and treatment of diseases like cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 642462-81-5 |
| Pricing | Inquire |
| Cas | 642462-81-5 |
| Molecular Weight | 797.88 |
| Molecular Formula | C42H52N7O7P |
| Canonical SMILES | CCNC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N |