R1128 B
R1128 B is a non-steroidal estrogen-receptor antagonist produced by Streptomyces sp. No. 1128. The IC50 value of R1128 B for partially purified rat uterine cytosol receptor was 1.2 x 10(-7) M.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03358 |
| Pricing | Inquire |
| Cas | 135161-97-6 |
| Molecular Weight | 312.3 |
| Molecular Formula | C18H16O5 |
| Canonical SMILES | CCCCC1=C2C(=CC(=C1)O)C(=O)C3=C(C2=O)C(=CC(=C3)O)O |