Ethyl 4-acetylbenzoate
Ethyl 4-acetylbenzoate (CAS# 38430-55-6) is used as a reagent to synthesize pyrazoles (e.g. 1H-Pyrazole [P842195]). Ethyl 4-acetylbenzoate is also used as a reagent to synthesize chiral hydrazines (e.g. (S)-[2-(Benzyloxy)propylidene]hydrazinecarboxaldehyde [B288000]) from the catalytic enantioselective hydrogenation of N-alkoxycarbonyl hydrazones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38430-55-6 |
| Pricing | Inquire |
| Cas | 38430-55-6 |
| Molecular Weight | 192.21 |
| Molecular Formula | C11H12O3 |
| Canonical SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)C |