Axitinib-[d3]
Axitinib-[d3] is the labelled analogue of Axitinib. Axitinib is a tyrosine kinase inhibitor that blocks the activation of VEGFR1, VEGFR2, VEGFR3, c-kit, and PDGFRβ (IC50 = 1.2, 0.25, 0.29, 1.7, and 1.6 nM, respectively). It has been shown to significantly inhibit growth of breast cancer in animal (xenograft) models.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011798 |
| Pricing | Inquire |
| Cas | 1126623-89-9 |
| Molecular Weight | 389.49 |
| Molecular Formula | C22H15D3N4OS |
| Canonical SMILES | CNC(=O)C1=CC=CC=C1SC2=CC3=C(C=C2)C(=NN3)C=CC4=CC=CC=N4 |