Prednisone Impurity 3
An impurity of Prednisone.Prednisone is a synthetic corticosteroid drug. It can be used for the treatment of certain inflammatory diseases, some autoimmune diseases, and (at higher doses) some types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72064-79-0 |
| Pricing | Inquire |
| Cas | 72064-79-0 |
| Molecular Weight | 486.61 |
| Molecular Formula | C28H38O7 |
| Canonical SMILES | CCCCC(=O)OC1(CCC2C1(CC(C3C2CCC4=CC(=O)C=CC34C)O)C)C(=O)COC(=O)C |