6-O-Tosyl-D-mannose
6-O-Tosyl-D-mannose, an indispensable compound within the biomedical sector, strategically tackles a diverse range of maladies. Boasting profound potential, this agent effectively combats bacterial and viral afflictions, encompassing tuberculosis and influenza. Its pivotal role in advancing novel antibiotics and antiviral agents stems from its potent antimicrobial attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105265-64-3 |
| Pricing | Inquire |
| Cas | 105265-64-3 |
| Molecular Weight | 334.34 |
| Molecular Formula | C13H18O8S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(C(C=O)O)O)O)O |