Resveratrol Impurity E
An impurity of Resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89946-06-5 |
| Pricing | Inquire |
| Cas | 89946-06-5 |
| Molecular Weight | 498.63 |
| Molecular Formula | C35H30O3 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=CC3=CC(=CC(=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |