(4R)-Benzyl-4-deoxy-4-C-nitromethyl-b-D-arabinopyranoside
(4R)-Benzyl-4-deoxy-4-C-nitromethyl-b-D-arabinopyranoside is a biomedical product utilized in the treatment of several diseases. This compound has shown potential in inhibiting the growth of various cancer cells and may be used in targeted drug delivery systems. Its molecular structure exhibits nitromethyl and benzyl groups, which contribute to its pharmacological activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383173-71-5 |
| Pricing | Inquire |
| Cas | 383173-71-5 |
| Molecular Weight | 283.28 |
| Molecular Formula | C13H17NO6 |
| Canonical SMILES | C1C(C(C(C(O1)OCC2=CC=CC=C2)O)O)C[N+](=O)[O-] |