3-Amino-4-hydroxybenzenesulfonic acid
3-Amino-4-hydroxybenzenesulfonic acid can be used to synthesize various heterocyclic Schiff bases for imaging applications. 3-Amino-4-hydroxybenzenesulfonic acid can also be used for comparative assessment in the Tetrahymena pyriformis growth inhibition assay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98-37-3 |
| Pricing | Inquire |
| Cas | 98-37-3 |
| Molecular Weight | 189.19 |
| Molecular Formula | C6H7NO4S |
| Canonical SMILES | C1=CC(=C(C=C1S(=O)(=O)O)N)O |