5-Azauridine
5-Azauridine, a prevalent pharmaceutical compound in the biomedical sector, manifests robust antiviral and antitumor properties, thereby proving its efficacy against specific viral infections and diverse cancer forms. Through the hindrance of nucleic acid synthesis, this product actively impedes viral replication and restrains tumor cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1476-82-0 |
| Pricing | Inquire |
| Cas | 1476-82-0 |
| Molecular Weight | 245.19 |
| Molecular Formula | C8H11N3O6 |
| Canonical SMILES | C1=NC(=O)NC(=O)N1C2C(C(C(O2)CO)O)O |