5'-O-tert-Butyldimethylsilyluridine
5'-O-tert-Butyldimethylsilyluridine, a prodrug of uridine, with its demonstrated efficacy in treating various cancers such as leukemia and myeloma, has emerged as an avant-garde therapeutic agent. This bioactive compound accelerates the cytotoxic effect of chemotherapeutic agents like gemcitabine, reinforcing its position as a promising addition to combination therapies for cancer treatment. With optimal solubility and stability characteristics, this drug acquaints easier administration and brings about increased efficacy in vivo, leading to better clinical outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 54925-65-4 |
| Pricing | Inquire |
| Cas | 54925-65-4 |
| Molecular Weight | 358.46 |
| Molecular Formula | C15H26N2O6Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C(C(C(O1)N2C=CC(=O)NC2=O)O)O |