6-Chloro-2-methoxypyridine-3-boronic acid
6-Chloro-2-methoxypyridine-3-boronic acid is an essential compound used in the biomedicine industry. It exhibits significant potential in the development of drugs for the treatment of various diseases. Through its unique chemical properties, it serves as a crucial building block for synthesizing pharmaceutical compounds targeting specific illnesses and disorders. The compound's versatility and efficacy make it a valuable tool in drug discovery and development processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008834 |
| Pricing | Inquire |
| Cas | 1072946-50-9 |
| Molecular Weight | 187.39 |
| Molecular Formula | C6H7BClNO3 |
| Canonical SMILES | B(C1=C(N=C(C=C1)Cl)OC)(O)O |