Uridine 5'-diphosphoglucose
Uridine 5'-diphosphoglucose is an indispensable biomolecule extensively employed in the biomedical sector, exerting a pivotal function in the synthesis of glycogen, glycosaminoglycans and glycolipids. Furthermore, its extensive application encompasses the research of metabolic ailments, including glycogen storage diseases and impairments associated with glycosylation dysfunction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 152697-45-5 |
| Pricing | Inquire |
| Cas | 152697-45-5 |
| Molecular Weight | 566.30 |
| Molecular Formula | C15H24N2O17P2 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O |