ML-098
ML-098, also called as CID-7345532, is an activator of the GTP-binding protein Rab7 (EC50 = 77.6 nM) with selectivity without disrupting related GTPases cdc42, Ras, Rab-2A, and Rac1 (EC50s = 588.8, 346.7, 158.5, and 794.3 nM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 878978-76-8 |
| Pricing | Inquire |
| Cas | 878978-76-8 |
| Molecular Weight | 309.36 |
| Molecular Formula | C19H19NO3 |
| Canonical SMILES | CC1=CC(=C(C=C1)C)OCCN2C=C(C3=CC=CC=C32)C(=O)O |