Methotrexate Impurity B
Aminopterin (Methotrexate Impurity B) is a folic acid antagonist. It is actively transported into cells by the folate transporter. It is also an impurity of Methotrexate, an antimetabolite, antifolate agent, immunosuppressant and antineoplastic agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-071237 |
| Pricing | 500 mg/unit USD $299 |
| Cas | 54-62-6 |
| Molecular Weight | 440.41 |
| Molecular Formula | C19H20N8O5 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N |