6-methyl-2,3-pyridinedicarboxylic acid
6-methyl-2,3-pyridinedicarboxylic acid is a constituent of paramount significance in the biomedical. Widely harnessed in the formulation of pharmaceuticals aimed at a wide range of afflictions, encompassing cancer and neurodegenerative maladies, its intricate therapeutic modalities elevate it to an auspicious contender. Through the manipulation of particular biological phenomena, it holds immense promise as a therapeutic agent, poised to combat these ailments with precision.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53636-70-7 |
| Pricing | Inquire |
| Cas | 53636-70-7 |
| Molecular Weight | 181.15 |
| Molecular Formula | C8H7NO4 |
| Canonical SMILES | CC1=NC(=C(C=C1)C(=O)O)C(=O)O |