(2'R)-N-Benzoyl-2'-deoxy-2'-fluoro-2'-Methylcytidine 3',5'-dibenzoate
2'-deoxy-2'-fluoro-2'-methylcytidine 3',5'-dibenzoate, commonly referred to as (2'R)-N-Benzoyl, is a powerful nucleoside analog with the ability to hinder viral polymerase activity, thereby preventing viral replication. It has obtained widespread recognition as an effective treatment for various viral infections such as Hepatitis B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 817204-32-3 |
| Pricing | Inquire |
| Cas | 817204-32-3 |
| Molecular Weight | 571.55 |
| Molecular Formula | C31H26FN3O7 |
| Canonical SMILES | CC1(C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)F |