3'-O-tert-Butyldimethylsilyl-2'-deoxy-5'-O-DMT-adenosine
3'-O-tert-Butyldimethylsilyl-2'-deoxy-5'-O-DMT-adenosine, an intricate and multifaceted compound, finds its utility within the biomedical industry with diverse and intriguing applications. Primarily deployed in drug synthesis and research, this compound assumes a pivotal role as a fundamental constituent for the synthesis of nucleoside analogs. This process bears immense significance in the advancement of antiviral drug development, illustrating its profound impact on therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89947-86-4 |
| Pricing | Inquire |
| Cas | 89947-86-4 |
| Molecular Weight | 667.87 |
| Molecular Formula | C37H45N5O5Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)N |