9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(5-phenylpyridin-3-yl)purine
9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(5-phenylpyridin-3-yl)purine, an exquisite compound widely employed in the biomedical field, exhibits remarkable potential as a selective and robust inhibitor against a spectrum of viral infections. By expertly targeting the viral polymerases, this inhibitor efficacy halts virus replication by meticulously impeding viral RNA synthesis. Consequently, it presents a highly promising avenue for combatting RNA virus-induced afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612191-96-4 |
| Pricing | Inquire |
| Cas | 1612191-96-4 |
| Molecular Weight | 407.40 |
| Molecular Formula | C21H18FN5O3 |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)C3=C4C(=NC=N3)N(C=N4)C5C(C(C(O5)CO)F)O |