Ezetimibe Impurity B
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L14) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870634-36-9 |
| Pricing | Inquire |
| Cas | 870634-36-9 |
| Molecular Weight | 226.25 |
| Molecular Formula | C12H15FO3 |
| Canonical SMILES | COC(=O)CCCC(C1=CC=C(C=C1)F)O |