Sorbistin B
It is an aminoglycoside antibiotic produced by the strain of Pseudomonas sorbicinii nov. sp. It has anti-gram-positive and negative bacteria effects. Sorbistin A1 has moderate antibacterial activity, but it is stronger than Sorbistin A2 and B. Sorbistin B has no anti-anaerobic effect, but it has anti-plant pathogenic bacteria effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02920 |
| Pricing | Inquire |
| Cas | 60502-99-0 |
| Molecular Weight | 383.40 |
| Molecular Formula | C14H29N3O9 |
| Canonical SMILES | CC(=O)NC1C(OC(C(C1O)O)OC(C(CN)O)C(C(CO)O)N)CO |