t-Boc-N-amido-PEG12-NHS ester
t-Boc-N-amido-PEG12-NHS ester is a PEG linker containing NHS ester and Boc-protected amine moieties. The Boc group can be deprotected under mildly acidic conditions to form a free amine. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-0566 |
| Pricing | Inquire |
| Molecular Weight | 814.92 |
| Molecular Formula | C36H66N2O18 |
| Canonical SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |