2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL is a biomedical compound bestowed with profound medicinal prospects. Renowned for its extraordinary antioxidant attributes, this wonderous solution finds extensive applications in remedial measures targeted at oxidative stress-induced illnesses. Given its distinctive and intricate molecular configuration, this exquisite entity emerges as an auspicious contender for pioneering the creation of groundbreaking pharmaceuticals, effectively countering a wide array of disorders arising from oxidative impairment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 269410-22-2 |
| Pricing | Inquire |
| Cas | 269410-22-2 |
| Molecular Weight | 250.1 |
| Molecular Formula | C13H19BO4 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)OC |