(+)-Biotin azidopropylamide
(+)-Biotin azidopropylamide, a scientific compound, is a highly effective labeling agent for proteins aimed at facilitating their affinity purification and detection. Its multifaceted role spans across understanding protein-protein interactions, molecular biology, and oncology whereby its application in the development of diagnostic assays for cancer has proven resourceful.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-168900 |
| Pricing | Inquire |
| Cas | 908007-17-0 |
| Molecular Weight | 326.42 |
| Molecular Formula | C13H22N6O2S |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NCCCN=[N+]=[N-])NC(=O)N2 |