3,6-O-Dibenzyl-4-O-tert-butyldimethylsilyl-2-tetrachlorophthalimide-1-benzenethiol-1,2-dideoxy-β-D-glucopyranose
3,6-O-diBenzyl-4-O-tert-butyldimethylsilyl-2-tetrachlorophthalimide-1-benzenethiol-1,2-dideoxy-β-D-glucopyranose is an intermediate formed in the synthesis of N-Acetylchitooctaose, a chitooligosaccharide used to activate Saccharomyces cerevisiae chitin biosynthesis. N-Acetylchitooctaose has affinity for NKR-P1A protein, the major activating receptor at the surface of rat natural killer (NK) cells, and may be useful in human therapy in cancer treatment (colon cancer, melanoma).
| Supplier | BOC Sciences |
|---|---|
| Product # | 935268-62-5 |
| Pricing | Inquire |
| Cas | 935268-62-5 |
| Molecular Weight | 833.72 |
| Molecular Formula | C40H41Cl4NO6SSi |
| Canonical SMILES | O=C1C=2C(Cl)=C(Cl)C(Cl)=C(Cl)C2C(=O)N1C3C(OC(COCC=4C=CC=CC4)C(O[Si](C)(C)C(C)(C)C)C3OCC=5C=CC=CC5)SC=6C=CC=CC6 |