Epidermal Growth Factor Receptor Peptide acetate
Epidermal Growth Factor Receptor Peptide exists on the cell surface and is activated by the binding of its specific ligands. EGFR belongs to the tyrosine kinase receptor (RTK) ErbB family.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016415 |
| Pricing | Inquire |
| Molecular Weight | 1436.52 |
| Molecular Formula | C63H97N13O25 |
| Canonical SMILES | CCC(C)C(C(=O)N1CCCC1C(=O)NC(CCC(=O)N)C(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C(CC(=O)O)N.CC(=O)O |