2-Perfluorohexyl-[1,1-2H2]-[1,2-[13C2]]-ethanol
2-Perfluorohexyl-[1,1-2H2]-[1,2-13C2]-ethanol is a labeled compound of 1H,1H,2H,2H-Tridecafluoro-1-n-octanol (T774750) which is a material used to improve nanotube composites. It is also used in the synthesis of a recyclable fluorous hydrazine carbothioate compound with NCS to catalyze the acetalization of aldehydes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-015653 |
| Pricing | Inquire |
| Cas | 872398-72-6 |
| Molecular Weight | 368.1 |
| Molecular Formula | C613C2H3D2F13O |
| Canonical SMILES | C(CO)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |