3'-O-(t-Butyldimethylsilyl)-5'-deoxy-5'-(1,3-diphenyl-2-imidazolidinyl)thymidine
3'-O-(t-Butyldimethylsilyl)-5'-deoxy-5'-(1,3-diphenyl-2-imidazolidinyl)thymidine is a crucial compound in biomedicine used for various applications. It functions as a potential antiviral agent, exhibiting promising activity against diseases caused by certain viruses. Its specialized formula allows it to efficiently target and inhibit the replication of specific viral strains, making it a valuable tool in virology research and antiviral drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149741-58-2 |
| Pricing | Inquire |
| Cas | 149741-58-2 |
| Molecular Weight | 548.75 |
| Molecular Formula | C30H40N4O4Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)C3N(CCN3C4=CC=CC=C4)C5=CC=CC=C5)O[Si](C)(C)C(C)(C)C |